C26H23BrFN3O5S — CID 135553714
2-bromo-4-[[2-(4-fluorophenyl)imino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol (PubChem CID 135553714) has the molecular formula C26H23BrFN3O5S and a molecular weight of 588.46 g/mol. Its IUPAC name is 2-bromo-4-[[2-(4-fluorophenyl)imino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol.
| Compound Name | 2-bromo-4-[[2-(4-fluorophenyl)imino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 135553714 |
| Molecular Formula | C26H23BrFN3O5S |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 587.05 |
| IUPAC Name | 2-bromo-4-[[2-(4-fluorophenyl)imino-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-6-methoxyphenol |
| SMILES | COc1cc(C=Nn2c(-c3cc(OC)c(OC)c(OC)c3)cs/c2=N\c2ccc(F)cc2)cc(Br)c1O |
| InChI | InChI=1S/C26H23BrFN3O5S/c1-33-21-10-15(9-19(27)24(21)32)13-29-31-20(14-37-26(31)30-18-7-5-17(28)6-8-18)16-11-22(34-2)25(36-4)23(12-16)35-3/h5-14,32H,1-4H3/b29-13?,30-26- |
| InChIKey | XHCIYCJYPDEEJT-LUCMGGPYSA-N |
| XLogP | 5.97 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|