C20H13F2N3S2 — CID 23989016
N,4-bis(4-fluorophenyl)-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23989016) has the molecular formula C20H13F2N3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N,4-bis(4-fluorophenyl)-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N,4-bis(4-fluorophenyl)-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23989016 |
| Molecular Formula | C20H13F2N3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N,4-bis(4-fluorophenyl)-3-(thiophen-3-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | Fc1ccc(/N=c2\scc(-c3ccc(F)cc3)n2N=Cc2ccsc2)cc1 |
| InChI | InChI=1S/C20H13F2N3S2/c21-16-3-1-15(2-4-16)19-13-27-20(24-18-7-5-17(22)6-8-18)25(19)23-11-14-9-10-26-12-14/h1-13H/b23-11?,24-20- |
| InChIKey | NJUQJWIYQUEICW-SIQQMNMFSA-N |
| XLogP | 5.67 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|