C21H15FN4O2S — CID 135840428
4-[[4-(4-fluorophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol (PubChem CID 135840428) has the molecular formula C21H15FN4O2S and a molecular weight of 406.44 g/mol. Its IUPAC name is 4-[[4-(4-fluorophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[4-(4-fluorophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135840428 |
| Molecular Formula | C21H15FN4O2S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 4-[[4-(4-fluorophenyl)-2-pyridin-3-ylimino-1,3-thiazol-3-yl]iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C=Nn2c(-c3ccc(F)cc3)cs/c2=N\c2cccnc2)c(O)c1 |
| InChI | InChI=1S/C21H15FN4O2S/c22-16-6-3-14(4-7-16)19-13-29-21(25-17-2-1-9-23-12-17)26(19)24-11-15-5-8-18(27)10-20(15)28/h1-13,27-28H/b24-11?,25-21- |
| InChIKey | BSQRQHMVVUICHP-FVKDKRHGSA-N |
| XLogP | 4.28 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|