C24H20FN3OS — CID 135824895
2-[[4-(4-fluorophenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]phenol (PubChem CID 135824895) has the molecular formula C24H20FN3OS and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]phenol.
| Compound Name | 2-[[4-(4-fluorophenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135824895 |
| Molecular Formula | C24H20FN3OS |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)-2-(2-phenylethylimino)-1,3-thiazol-3-yl]iminomethyl]phenol |
| SMILES | Oc1ccccc1C=Nn1c(-c2ccc(F)cc2)cs/c1=N\CCc1ccccc1 |
| InChI | InChI=1S/C24H20FN3OS/c25-21-12-10-19(11-13-21)22-17-30-24(26-15-14-18-6-2-1-3-7-18)28(22)27-16-20-8-4-5-9-23(20)29/h1-13,16-17,29H,14-15H2/b26-24-,27-16? |
| InChIKey | UVYGKQGQAHFEJD-KZZIXVDKSA-N |
| XLogP | 5.09 |
| TPSA | 49.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|