C29H24N4S — CID 2364664
N-(2-phenylethyl)-4-(4-phenylphenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 2364664) has the molecular formula C29H24N4S and a molecular weight of 460.61 g/mol. Its IUPAC name is N-(2-phenylethyl)-4-(4-phenylphenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-(2-phenylethyl)-4-(4-phenylphenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2364664 |
| Molecular Formula | C29H24N4S |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-(2-phenylethyl)-4-(4-phenylphenyl)-3-(pyridin-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | C(=Nn1c(-c2ccc(-c3ccccc3)cc2)cs/c1=N\CCc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C29H24N4S/c1-3-9-23(10-4-1)18-20-31-29-33(32-21-27-13-7-8-19-30-27)28(22-34-29)26-16-14-25(15-17-26)24-11-5-2-6-12-24/h1-17,19,21-22H,18,20H2/b31-29-,32-21? |
| InChIKey | QVKOBBVPOLATDP-NHSUXCQZSA-N |
| XLogP | 6.30 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|