C21H19N5OS — CID 9368300
(Z)-N-(2-methoxyethyl)-4-phenyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]-1,3-thiazol-2-imine (PubChem CID 9368300) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is (Z)-N-(2-methoxyethyl)-4-phenyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (Z)-N-(2-methoxyethyl)-4-phenyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 9368300 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | (Z)-N-(2-methoxyethyl)-4-phenyl-3-[(Z)-quinoxalin-2-ylmethylideneamino]-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccccc2)n1/N=C\c1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H19N5OS/c1-27-12-11-22-21-26(20(15-28-21)16-7-3-2-4-8-16)24-14-17-13-23-18-9-5-6-10-19(18)25-17/h2-10,13-15H,11-12H2,1H3/b22-21-,24-14- |
| InChIKey | FMBOYUAFVNFAQI-OMOXKELOSA-N |
| XLogP | 3.59 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|