C16H16N4OS2 — CID 9368245
(Z)-N-(2-methoxyethyl)-3-[(Z)-pyridin-2-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 9368245) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is (Z)-N-(2-methoxyethyl)-3-[(Z)-pyridin-2-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | (Z)-N-(2-methoxyethyl)-3-[(Z)-pyridin-2-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 9368245 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (Z)-N-(2-methoxyethyl)-3-[(Z)-pyridin-2-ylmethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2cccs2)n1/N=C\c1ccccn1 |
| InChI | InChI=1S/C16H16N4OS2/c1-21-9-8-18-16-20(19-11-13-5-2-3-7-17-13)14(12-23-16)15-6-4-10-22-15/h2-7,10-12H,8-9H2,1H3/b18-16-,19-11- |
| InChIKey | HFEFPJNOTIISJE-WHBZEJOESA-N |
| XLogP | 3.10 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|