C20H21N3O2S — CID 7975500
(Z)-N-(2-methoxyethyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine (PubChem CID 7975500) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is (Z)-N-(2-methoxyethyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | (Z)-N-(2-methoxyethyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7975500 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (Z)-N-(2-methoxyethyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccccc2)n1/N=C\c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-24-13-12-21-20-23(19(15-26-20)17-6-4-3-5-7-17)22-14-16-8-10-18(25-2)11-9-16/h3-11,14-15H,12-13H2,1-2H3/b21-20-,22-14- |
| InChIKey | IQTVJYYOENSPLI-NCCABJSSSA-N |
| XLogP | 3.65 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|