C21H20BrN3O3S — CID 2364898
4-(4-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(2-methoxyethyl)-1,3-thiazol-2-imine (PubChem CID 2364898) has the molecular formula C21H20BrN3O3S and a molecular weight of 474.38 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(2-methoxyethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2364898 |
| Molecular Formula | C21H20BrN3O3S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 4-(4-bromophenyl)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccc(Br)cc2)n1N=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H20BrN3O3S/c1-26-9-8-23-21-25(18(14-29-21)16-3-5-17(22)6-4-16)24-13-15-2-7-19-20(12-15)28-11-10-27-19/h2-7,12-14H,8-11H2,1H3/b23-21-,24-13? |
| InChIKey | JUIUPNDCXOILDD-NYHUNQEVSA-N |
| XLogP | 4.18 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|