C20H17FN4OS — CID 7975619
4-[(Z)-[4-(4-fluorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile (PubChem CID 7975619) has the molecular formula C20H17FN4OS and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-[(Z)-[4-(4-fluorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile.
| Compound Name | 4-[(Z)-[4-(4-fluorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 7975619 |
| Molecular Formula | C20H17FN4OS |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[(Z)-[4-(4-fluorophenyl)-2-(2-methoxyethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| SMILES | COCC/N=c1\scc(-c2ccc(F)cc2)n1/N=C\c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H17FN4OS/c1-26-11-10-23-20-25(24-13-16-4-2-15(12-22)3-5-16)19(14-27-20)17-6-8-18(21)9-7-17/h2-9,13-14H,10-11H2,1H3/b23-20-,24-13- |
| InChIKey | BYKCOLHTIRWFPS-IJEJUYEZSA-N |
| XLogP | 3.66 |
| TPSA | 62.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|