C22H19FN4OS — CID 7974775
4-[(Z)-[4-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazol-3-yl]iminomethyl]benzonitrile (PubChem CID 7974775) has the molecular formula C22H19FN4OS and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-[(Z)-[4-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazol-3-yl]iminomethyl]benzonitrile.
| Compound Name | 4-[(Z)-[4-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 7974775 |
| Molecular Formula | C22H19FN4OS |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-[(Z)-[4-(4-fluorophenyl)-2-[[(2R)-oxolan-2-yl]methylimino]-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=N\n2c(-c3ccc(F)cc3)cs/c2=N\C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H19FN4OS/c23-19-9-7-18(8-10-19)21-15-29-22(25-14-20-2-1-11-28-20)27(21)26-13-17-5-3-16(12-24)4-6-17/h3-10,13,15,20H,1-2,11,14H2/b25-22-,26-13-/t20-/m1/s1 |
| InChIKey | BZQKEJJRYIEYTJ-PXNCLCJMSA-N |
| XLogP | 4.19 |
| TPSA | 62.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|