C30H31N3OS — CID 5021468
N-(oxolan-2-ylmethyl)-3-[(4-phenylphenyl)methylideneamino]-4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-imine (PubChem CID 5021468) has the molecular formula C30H31N3OS and a molecular weight of 481.67 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-3-[(4-phenylphenyl)methylideneamino]-4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(oxolan-2-ylmethyl)-3-[(4-phenylphenyl)methylideneamino]-4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 5021468 |
| Molecular Formula | C30H31N3OS |
| Molecular Weight | 481.67 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-3-[(4-phenylphenyl)methylideneamino]-4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1cc(C)c(-c2cs/c(=N\CC3CCCO3)n2N=Cc2ccc(-c3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C30H31N3OS/c1-21-16-23(3)28(17-22(21)2)29-20-35-30(31-19-27-10-7-15-34-27)33(29)32-18-24-11-13-26(14-12-24)25-8-5-4-6-9-25/h4-6,8-9,11-14,16-18,20,27H,7,10,15,19H2,1-3H3/b31-30-,32-18? |
| InChIKey | IEOFMUMONDYOIY-RZRLTFHKSA-N |
| XLogP | 6.77 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|