C23H24BrN3OS — CID 4016060
4-(4-bromophenyl)-3-[(4-ethylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine (PubChem CID 4016060) has the molecular formula C23H24BrN3OS and a molecular weight of 470.44 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-[(4-ethylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-bromophenyl)-3-[(4-ethylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4016060 |
| Molecular Formula | C23H24BrN3OS |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 4-(4-bromophenyl)-3-[(4-ethylphenyl)methylideneamino]-N-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(C=Nn2c(-c3ccc(Br)cc3)cs/c2=N\CC2CCCO2)cc1 |
| InChI | InChI=1S/C23H24BrN3OS/c1-2-17-5-7-18(8-6-17)14-26-27-22(19-9-11-20(24)12-10-19)16-29-23(27)25-15-21-4-3-13-28-21/h5-12,14,16,21H,2-4,13,15H2,1H3/b25-23-,26-14? |
| InChIKey | OZZYMYATVNDVBV-REWQIIKUSA-N |
| XLogP | 5.50 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|