C23H28N4S — CID 2372317
N,N-diethyl-4-[[4-(4-ethylphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]aniline (PubChem CID 2372317) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-(4-ethylphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]aniline.
| Compound Name | N,N-diethyl-4-[[4-(4-ethylphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]aniline |
|---|---|
| PubChem CID | 2372317 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N,N-diethyl-4-[[4-(4-ethylphenyl)-2-methylimino-1,3-thiazol-3-yl]iminomethyl]aniline |
| SMILES | CCc1ccc(-c2cs/c(=N\C)n2N=Cc2ccc(N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C23H28N4S/c1-5-18-8-12-20(13-9-18)22-17-28-23(24-4)27(22)25-16-19-10-14-21(15-11-19)26(6-2)7-3/h8-17H,5-7H2,1-4H3/b24-23-,25-16? |
| InChIKey | HLWQCLMPEFWLOF-CTQCDUDSSA-N |
| XLogP | 5.04 |
| TPSA | 32.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|