C27H27BrN4OS — CID 6902876
4-[(E)-[4-(4-bromophenyl)-2-(2-methoxyphenyl)imino-1,3-thiazol-3-yl]iminomethyl]-N,N-diethylaniline (PubChem CID 6902876) has the molecular formula C27H27BrN4OS and a molecular weight of 535.51 g/mol. Its IUPAC name is 4-[(E)-[4-(4-bromophenyl)-2-(2-methoxyphenyl)imino-1,3-thiazol-3-yl]iminomethyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-[4-(4-bromophenyl)-2-(2-methoxyphenyl)imino-1,3-thiazol-3-yl]iminomethyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 6902876 |
| Molecular Formula | C27H27BrN4OS |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 4-[(E)-[4-(4-bromophenyl)-2-(2-methoxyphenyl)imino-1,3-thiazol-3-yl]iminomethyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=N/n2c(-c3ccc(Br)cc3)cs/c2=N\c2ccccc2OC)cc1 |
| InChI | InChI=1S/C27H27BrN4OS/c1-4-31(5-2)23-16-10-20(11-17-23)18-29-32-25(21-12-14-22(28)15-13-21)19-34-27(32)30-24-8-6-7-9-26(24)33-3/h6-19H,4-5H2,1-3H3/b29-18+,30-27- |
| InChIKey | NAASTYAEXHNUGO-ORPWNYHKSA-N |
| XLogP | 6.95 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|