C23H16BrF2N3OS — CID 2415514
3-[(5-bromo-2-methoxyphenyl)methylideneamino]-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine (PubChem CID 2415514) has the molecular formula C23H16BrF2N3OS and a molecular weight of 500.37 g/mol. Its IUPAC name is 3-[(5-bromo-2-methoxyphenyl)methylideneamino]-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(5-bromo-2-methoxyphenyl)methylideneamino]-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2415514 |
| Molecular Formula | C23H16BrF2N3OS |
| Molecular Weight | 500.37 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 3-[(5-bromo-2-methoxyphenyl)methylideneamino]-N,4-bis(4-fluorophenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(Br)cc1C=Nn1c(-c2ccc(F)cc2)cs/c1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C23H16BrF2N3OS/c1-30-22-11-4-17(24)12-16(22)13-27-29-21(15-2-5-18(25)6-3-15)14-31-23(29)28-20-9-7-19(26)8-10-20/h2-14H,1H3/b27-13?,28-23- |
| InChIKey | JRSSYBCCCCZHTR-ONPAYIQCSA-N |
| XLogP | 6.38 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.37 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|