C25H21F2N3O4S — CID 135709905
2-[[2-(2,4-difluorophenyl)imino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-4-methoxyphenol (PubChem CID 135709905) has the molecular formula C25H21F2N3O4S and a molecular weight of 497.52 g/mol. Its IUPAC name is 2-[[2-(2,4-difluorophenyl)imino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-4-methoxyphenol.
| Compound Name | 2-[[2-(2,4-difluorophenyl)imino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135709905 |
| Molecular Formula | C25H21F2N3O4S |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[[2-(2,4-difluorophenyl)imino-4-(2,5-dimethoxyphenyl)-1,3-thiazol-3-yl]iminomethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C=Nn2c(-c3cc(OC)ccc3OC)cs/c2=N\c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C25H21F2N3O4S/c1-32-17-5-8-23(31)15(10-17)13-28-30-22(19-12-18(33-2)6-9-24(19)34-3)14-35-25(30)29-21-7-4-16(26)11-20(21)27/h4-14,31H,1-3H3/b28-13?,29-25- |
| InChIKey | KUGZTTKIKMRIHZ-YALABBGYSA-N |
| XLogP | 5.34 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|