C22H18F2N4O2S — CID 135759349
N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 135759349) has the molecular formula C22H18F2N4O2S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135759349 |
| Molecular Formula | C22H18F2N4O2S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccc(F)cc3F)n2N=Cc2ccc[nH]2)c1 |
| InChI | InChI=1S/C22H18F2N4O2S/c1-29-16-6-8-21(30-2)17(11-16)20-13-31-22(27-19-7-5-14(23)10-18(19)24)28(20)26-12-15-4-3-9-25-15/h3-13,25H,1-2H3/b26-12?,27-22- |
| InChIKey | DWWOTLUHJXTQHU-ZAVVKNGVSA-N |
| XLogP | 4.95 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|