C15H13FN4S — CID 135721992
4-(4-fluorophenyl)-N-methyl-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 135721992) has the molecular formula C15H13FN4S and a molecular weight of 300.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-methyl-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-(4-fluorophenyl)-N-methyl-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135721992 |
| Molecular Formula | C15H13FN4S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-(4-fluorophenyl)-N-methyl-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(F)cc2)n1N=Cc1ccc[nH]1 |
| InChI | InChI=1S/C15H13FN4S/c1-17-15-20(19-9-13-3-2-8-18-13)14(10-21-15)11-4-6-12(16)7-5-11/h2-10,18H,1H3/b17-15-,19-9? |
| InChIKey | BAZIDASIFWOCJH-HASFGEJRSA-N |
| XLogP | 3.10 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|