C14H14N4OS — CID 2459841
N-ethyl-4-(furan-2-yl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 2459841) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-yl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-ethyl-4-(furan-2-yl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2459841 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N-ethyl-4-(furan-2-yl)-3-(1H-pyrrol-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccco2)n1N=Cc1ccc[nH]1 |
| InChI | InChI=1S/C14H14N4OS/c1-2-15-14-18(17-9-11-5-3-7-16-11)12(10-20-14)13-6-4-8-19-13/h3-10,16H,2H2,1H3/b15-14-,17-9? |
| InChIKey | VEJFYGUMFDWIHK-AWPOCNHNSA-N |
| XLogP | 2.94 |
| TPSA | 58.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|