C18H15BrN4OS — CID 135580167
3-[(5-bromo-1H-indol-3-yl)methylideneamino]-N-ethyl-4-(furan-2-yl)-1,3-thiazol-2-imine (PubChem CID 135580167) has the molecular formula C18H15BrN4OS and a molecular weight of 415.32 g/mol. Its IUPAC name is 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-N-ethyl-4-(furan-2-yl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-N-ethyl-4-(furan-2-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 135580167 |
| Molecular Formula | C18H15BrN4OS |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-N-ethyl-4-(furan-2-yl)-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccco2)n1N=Cc1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C18H15BrN4OS/c1-2-20-18-23(16(11-25-18)17-4-3-7-24-17)22-10-12-9-21-15-6-5-13(19)8-14(12)15/h3-11,21H,2H2,1H3/b20-18-,22-10? |
| InChIKey | FZLNYQRNHPXFMU-WZFPCHQNSA-N |
| XLogP | 4.86 |
| TPSA | 58.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|