C19H17BrN4O2S — CID 2473772
3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(furan-2-yl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine (PubChem CID 2473772) has the molecular formula C19H17BrN4O2S and a molecular weight of 445.34 g/mol. Its IUPAC name is 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(furan-2-yl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(furan-2-yl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2473772 |
| Molecular Formula | C19H17BrN4O2S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(furan-2-yl)-N-(2-methoxyethyl)-1,3-thiazol-2-imine |
| SMILES | COCC/N=c1\scc(-c2ccco2)n1N=Cc1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C19H17BrN4O2S/c1-25-8-6-21-19-24(17(12-27-19)18-3-2-7-26-18)23-11-13-10-22-16-5-4-14(20)9-15(13)16/h2-5,7,9-12,22H,6,8H2,1H3/b21-19-,23-11? |
| InChIKey | DNQIOYKFHPYEQS-GEAPJONHSA-N |
| XLogP | 4.48 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|