C24H23N3O4S — CID 23878510
N-benzyl-4-(furan-2-yl)-3-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23878510) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-benzyl-4-(furan-2-yl)-3-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | N-benzyl-4-(furan-2-yl)-3-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23878510 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-benzyl-4-(furan-2-yl)-3-[(2,3,4-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | COc1ccc(C=Nn2c(-c3ccco3)cs/c2=N\Cc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C24H23N3O4S/c1-28-21-12-11-18(22(29-2)23(21)30-3)15-26-27-19(20-10-7-13-31-20)16-32-24(27)25-14-17-8-5-4-6-9-17/h4-13,15-16H,14H2,1-3H3/b25-24-,26-15? |
| InChIKey | SCJJWEJHCVQLHA-PJVDOAQVSA-N |
| XLogP | 4.82 |
| TPSA | 70.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|