C18H19N3OS — CID 23876038
N-benzyl-3-(butan-2-ylideneamino)-4-(furan-2-yl)-1,3-thiazol-2-imine (PubChem CID 23876038) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is N-benzyl-3-(butan-2-ylideneamino)-4-(furan-2-yl)-1,3-thiazol-2-imine.
| Compound Name | N-benzyl-3-(butan-2-ylideneamino)-4-(furan-2-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23876038 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-benzyl-3-(butan-2-ylideneamino)-4-(furan-2-yl)-1,3-thiazol-2-imine |
| SMILES | CCC(C)=Nn1c(-c2ccco2)cs/c1=N\Cc1ccccc1 |
| InChI | InChI=1S/C18H19N3OS/c1-3-14(2)20-21-16(17-10-7-11-22-17)13-23-18(21)19-12-15-8-5-4-6-9-15/h4-11,13H,3,12H2,1-2H3/b19-18-,20-14? |
| InChIKey | MVLDQAKBZOJCCR-BVZGNOLBSA-N |
| XLogP | 4.54 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|