C22H23N3S — CID 23733179
4-phenyl-3-(4-phenylbutan-2-ylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23733179) has the molecular formula C22H23N3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 4-phenyl-3-(4-phenylbutan-2-ylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-phenyl-3-(4-phenylbutan-2-ylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23733179 |
| Molecular Formula | C22H23N3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-phenyl-3-(4-phenylbutan-2-ylideneamino)-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccccc2)n1N=C(C)CCc1ccccc1 |
| InChI | InChI=1S/C22H23N3S/c1-3-16-23-22-25(21(17-26-22)20-12-8-5-9-13-20)24-18(2)14-15-19-10-6-4-7-11-19/h3-13,17H,1,14-16H2,2H3/b23-22-,24-18? |
| InChIKey | ZKKDHAYMQPTPPR-NPGRVFEXSA-N |
| XLogP | 5.16 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|