C21H20BrN3O2S — CID 135554108
2-[N-[4-(4-bromophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol (PubChem CID 135554108) has the molecular formula C21H20BrN3O2S and a molecular weight of 458.38 g/mol. Its IUPAC name is 2-[N-[4-(4-bromophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol.
| Compound Name | 2-[N-[4-(4-bromophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 135554108 |
| Molecular Formula | C21H20BrN3O2S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-[N-[4-(4-bromophenyl)-2-prop-2-enylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]-5-methoxyphenol |
| SMILES | C=CC/N=c1\scc(-c2ccc(Br)cc2)n1N=C(C)c1ccc(OC)cc1O |
| InChI | InChI=1S/C21H20BrN3O2S/c1-4-11-23-21-25(19(13-28-21)15-5-7-16(22)8-6-15)24-14(2)18-10-9-17(27-3)12-20(18)26/h4-10,12-13,26H,1,11H2,2-3H3/b23-21-,24-14? |
| InChIKey | WORYTLBNSCVDKB-VPPYWVBKSA-N |
| XLogP | 5.05 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|