C19H18ClN3O2S — CID 135625685
4-[N-[4-(4-chlorophenyl)-2-ethylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol (PubChem CID 135625685) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is 4-[N-[4-(4-chlorophenyl)-2-ethylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[N-[4-(4-chlorophenyl)-2-ethylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135625685 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 4-[N-[4-(4-chlorophenyl)-2-ethylimino-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol |
| SMILES | CC/N=c1\scc(-c2ccc(Cl)cc2)n1N=C(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C19H18ClN3O2S/c1-3-21-19-23(17(11-26-19)13-4-6-14(20)7-5-13)22-12(2)16-9-8-15(24)10-18(16)25/h4-11,24-25H,3H2,1-2H3/b21-19-,22-12? |
| InChIKey | OAHVJPPEZMDJBK-UCTLZQNBSA-N |
| XLogP | 4.47 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|