C18H17N3O2S — CID 135856252
4-[C-methyl-N-(2-methylimino-4-phenyl-1,3-thiazol-3-yl)carbonimidoyl]benzene-1,3-diol (PubChem CID 135856252) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-[C-methyl-N-(2-methylimino-4-phenyl-1,3-thiazol-3-yl)carbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[C-methyl-N-(2-methylimino-4-phenyl-1,3-thiazol-3-yl)carbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135856252 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-[C-methyl-N-(2-methylimino-4-phenyl-1,3-thiazol-3-yl)carbonimidoyl]benzene-1,3-diol |
| SMILES | C/N=c1\scc(-c2ccccc2)n1N=C(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C18H17N3O2S/c1-12(15-9-8-14(22)10-17(15)23)20-21-16(11-24-18(21)19-2)13-6-4-3-5-7-13/h3-11,22-23H,1-2H3/b19-18-,20-12? |
| InChIKey | ZRZWRCRSLPCCRC-XEAJZJHLSA-N |
| XLogP | 3.43 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|