C23H21N3O2S2 — CID 135739971
4-[N-[2-(3,4-dimethylphenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol (PubChem CID 135739971) has the molecular formula C23H21N3O2S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[N-[2-(3,4-dimethylphenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol.
| Compound Name | 4-[N-[2-(3,4-dimethylphenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135739971 |
| Molecular Formula | C23H21N3O2S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 4-[N-[2-(3,4-dimethylphenyl)imino-4-thiophen-2-yl-1,3-thiazol-3-yl]-C-methylcarbonimidoyl]benzene-1,3-diol |
| SMILES | CC(=Nn1c(-c2cccs2)cs/c1=N\c1ccc(C)c(C)c1)c1ccc(O)cc1O |
| InChI | InChI=1S/C23H21N3O2S2/c1-14-6-7-17(11-15(14)2)24-23-26(20(13-30-23)22-5-4-10-29-22)25-16(3)19-9-8-18(27)12-21(19)28/h4-13,27-28H,1-3H3/b24-23-,25-16? |
| InChIKey | OWDLXHGYQRZZHZ-CTQCDUDSSA-N |
| XLogP | 5.81 |
| TPSA | 70.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|