C24H22N4O2S2 — CID 23993638
N-(2,6-dimethylphenyl)-3-[1-(4-methyl-3-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23993638) has the molecular formula C24H22N4O2S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-[1-(4-methyl-3-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(2,6-dimethylphenyl)-3-[1-(4-methyl-3-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23993638 |
| Molecular Formula | C24H22N4O2S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-[1-(4-methyl-3-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2cccs2)cs/c1=N\c1c(C)cccc1C)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H22N4O2S2/c1-15-10-11-19(13-20(15)28(29)30)18(4)26-27-21(22-9-6-12-31-22)14-32-24(27)25-23-16(2)7-5-8-17(23)3/h5-14H,1-4H3/b25-24-,26-18? |
| InChIKey | SGZPKLPKIHYNIF-UGHKPRIHSA-N |
| XLogP | 6.62 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|