C23H20N4O2S2 — CID 23964786
N-(3,4-dimethylphenyl)-3-[1-(4-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23964786) has the molecular formula C23H20N4O2S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-[1-(4-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(3,4-dimethylphenyl)-3-[1-(4-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23964786 |
| Molecular Formula | C23H20N4O2S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-[1-(4-nitrophenyl)ethylideneamino]-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2cccs2)cs/c1=N\c1ccc(C)c(C)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H20N4O2S2/c1-15-6-9-19(13-16(15)2)24-23-26(21(14-31-23)22-5-4-12-30-22)25-17(3)18-7-10-20(11-8-18)27(28)29/h4-14H,1-3H3/b24-23-,25-17? |
| InChIKey | FAEBNZJNEKDXAG-FURJNMMNSA-N |
| XLogP | 6.31 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|