C22H22N4O2S — CID 23767388
3-[1-(4-methylphenyl)ethylideneamino]-N-(2-methylprop-2-enyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23767388) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-[1-(4-methylphenyl)ethylideneamino]-N-(2-methylprop-2-enyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(4-methylphenyl)ethylideneamino]-N-(2-methylprop-2-enyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23767388 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[1-(4-methylphenyl)ethylideneamino]-N-(2-methylprop-2-enyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(-c2ccc([N+](=O)[O-])cc2)n1N=C(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-15(2)13-23-22-25(24-17(4)18-7-5-16(3)6-8-18)21(14-29-22)19-9-11-20(12-10-19)26(27)28/h5-12,14H,1,13H2,2-4H3/b23-22-,24-17? |
| InChIKey | TZVKFMKPFNNZFE-AMQXAWOUSA-N |
| XLogP | 5.18 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|