C27H22N6O2S — CID 23961993
3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-N-(2-methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23961993) has the molecular formula C27H22N6O2S and a molecular weight of 494.58 g/mol. Its IUPAC name is 3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-N-(2-methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-N-(2-methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23961993 |
| Molecular Formula | C27H22N6O2S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-N-(2-methylphenyl)-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2ccc([N+](=O)[O-])cc2)cs/c1=N\c1ccccc1C)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C27H22N6O2S/c1-19-5-3-4-6-25(19)29-27-32(26(17-36-27)22-9-13-24(14-10-22)33(34)35)30-20(2)21-7-11-23(12-8-21)31-16-15-28-18-31/h3-18H,1-2H3/b29-27-,30-20? |
| InChIKey | XERWYAXFAPNMQN-FTYIQYLHSA-N |
| XLogP | 6.12 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|