C30H28N4O2S — CID 23798493
N-cyclohexyl-3-[1-(9H-fluoren-2-yl)ethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-imine (PubChem CID 23798493) has the molecular formula C30H28N4O2S and a molecular weight of 508.65 g/mol. Its IUPAC name is N-cyclohexyl-3-[1-(9H-fluoren-2-yl)ethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-imine.
| Compound Name | N-cyclohexyl-3-[1-(9H-fluoren-2-yl)ethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23798493 |
| Molecular Formula | C30H28N4O2S |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-cyclohexyl-3-[1-(9H-fluoren-2-yl)ethylideneamino]-4-(4-nitrophenyl)-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2ccc([N+](=O)[O-])cc2)cs/c1=N\C1CCCCC1)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C30H28N4O2S/c1-20(22-13-16-28-24(17-22)18-23-7-5-6-10-27(23)28)32-33-29(21-11-14-26(15-12-21)34(35)36)19-37-30(33)31-25-8-3-2-4-9-25/h5-7,10-17,19,25H,2-4,8-9,18H2,1H3/b31-30-,32-20? |
| InChIKey | XFAVDTUVQHLGTQ-DVGYYIJASA-N |
| XLogP | 7.20 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|