C20H18BrClN4O2S — CID 23824830
4-(4-bromophenyl)-3-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine (PubChem CID 23824830) has the molecular formula C20H18BrClN4O2S and a molecular weight of 493.81 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(4-bromophenyl)-3-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23824830 |
| Molecular Formula | C20H18BrClN4O2S |
| Molecular Weight | 493.81 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | 4-(4-bromophenyl)-3-[1-(4-chloro-3-nitrophenyl)ethylideneamino]-N-propan-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2ccc(Br)cc2)cs/c1=N\C(C)C)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18BrClN4O2S/c1-12(2)23-20-25(19(11-29-20)14-4-7-16(21)8-5-14)24-13(3)15-6-9-17(22)18(10-15)26(27)28/h4-12H,1-3H3/b23-20-,24-13? |
| InChIKey | FFUHCGXXDUSLFN-LXMJKDPWSA-N |
| XLogP | 6.12 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.81 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|