C19H21N3OS — CID 23908285
3-[1-(furan-2-yl)ethylideneamino]-4-(4-methylphenyl)-N-propan-2-yl-1,3-thiazol-2-imine (PubChem CID 23908285) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)ethylideneamino]-4-(4-methylphenyl)-N-propan-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(furan-2-yl)ethylideneamino]-4-(4-methylphenyl)-N-propan-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23908285 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-[1-(furan-2-yl)ethylideneamino]-4-(4-methylphenyl)-N-propan-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2ccc(C)cc2)cs/c1=N\C(C)C)c1ccco1 |
| InChI | InChI=1S/C19H21N3OS/c1-13(2)20-19-22(21-15(4)18-6-5-11-23-18)17(12-24-19)16-9-7-14(3)8-10-16/h5-13H,1-4H3/b20-19-,21-15? |
| InChIKey | ZJZRIJROQGWSGU-JXOAEDSTSA-N |
| XLogP | 4.70 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|