C16H17N3OS2 — CID 23912172
3-[1-(furan-2-yl)ethylideneamino]-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23912172) has the molecular formula C16H17N3OS2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)ethylideneamino]-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(furan-2-yl)ethylideneamino]-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23912172 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-[1-(furan-2-yl)ethylideneamino]-N-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2cccs2)cs/c1=N\C(C)C)c1ccco1 |
| InChI | InChI=1S/C16H17N3OS2/c1-11(2)17-16-19(18-12(3)14-6-4-8-20-14)13(10-22-16)15-7-5-9-21-15/h4-11H,1-3H3/b17-16-,18-12? |
| InChIKey | CURSCTGZHNHZFN-QELPZIAFSA-N |
| XLogP | 4.45 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|