C19H21N3O3S — CID 6283588
(Z)-4-(2,5-dimethoxyphenyl)-N-ethyl-3-[(Z)-1-(furan-2-yl)ethylideneamino]-1,3-thiazol-2-imine (PubChem CID 6283588) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is (Z)-4-(2,5-dimethoxyphenyl)-N-ethyl-3-[(Z)-1-(furan-2-yl)ethylideneamino]-1,3-thiazol-2-imine.
| Compound Name | (Z)-4-(2,5-dimethoxyphenyl)-N-ethyl-3-[(Z)-1-(furan-2-yl)ethylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 6283588 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (Z)-4-(2,5-dimethoxyphenyl)-N-ethyl-3-[(Z)-1-(furan-2-yl)ethylideneamino]-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2cc(OC)ccc2OC)n1/N=C(/C)c1ccco1 |
| InChI | InChI=1S/C19H21N3O3S/c1-5-20-19-22(21-13(2)17-7-6-10-25-17)16(12-26-19)15-11-14(23-3)8-9-18(15)24-4/h6-12H,5H2,1-4H3/b20-19-,21-13- |
| InChIKey | YEOMQAMBEFCHPQ-NUEXEKADSA-N |
| XLogP | 4.02 |
| TPSA | 61.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|