C26H26N4O4S — CID 23936246
4-(2,5-dimethoxyphenyl)-3-[1-(2,5-dimethoxyphenyl)ethylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23936246) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-3-[1-(2,5-dimethoxyphenyl)ethylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-3-[1-(2,5-dimethoxyphenyl)ethylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23936246 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-3-[1-(2,5-dimethoxyphenyl)ethylideneamino]-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(C(C)=Nn2c(-c3cc(OC)ccc3OC)cs/c2=N\c2cccnc2)c1 |
| InChI | InChI=1S/C26H26N4O4S/c1-17(21-13-19(31-2)8-10-24(21)33-4)29-30-23(22-14-20(32-3)9-11-25(22)34-5)16-35-26(30)28-18-7-6-12-27-15-18/h6-16H,1-5H3/b28-26-,29-17? |
| InChIKey | UNLNADOZXLELMZ-KJXGIHTLSA-N |
| XLogP | 5.15 |
| TPSA | 79.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|