C25H23N5OS — CID 23903651
3-(3-imidazol-1-ylpropyl)-4-(6-methoxynaphthalen-2-yl)-N-pyridin-3-yl-1,3-thiazol-2-imine (PubChem CID 23903651) has the molecular formula C25H23N5OS and a molecular weight of 441.56 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropyl)-4-(6-methoxynaphthalen-2-yl)-N-pyridin-3-yl-1,3-thiazol-2-imine.
| Compound Name | 3-(3-imidazol-1-ylpropyl)-4-(6-methoxynaphthalen-2-yl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23903651 |
| Molecular Formula | C25H23N5OS |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 3-(3-imidazol-1-ylpropyl)-4-(6-methoxynaphthalen-2-yl)-N-pyridin-3-yl-1,3-thiazol-2-imine |
| SMILES | COc1ccc2cc(-c3cs/c(=N\c4cccnc4)n3CCCn3ccnc3)ccc2c1 |
| InChI | InChI=1S/C25H23N5OS/c1-31-23-8-7-19-14-21(6-5-20(19)15-23)24-17-32-25(28-22-4-2-9-26-16-22)30(24)12-3-11-29-13-10-27-18-29/h2,4-10,13-18H,3,11-12H2,1H3/b28-25- |
| InChIKey | CJEITBSQUKMULU-FVDSYPCUSA-N |
| XLogP | 5.29 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|