About 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide
3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide (PubChem CID 42917360) has the molecular formula C18H18BrN5S2
and a molecular weight of 448.42 g/mol. Its IUPAC name is 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide.
Molecular Properties
| Compound Name | 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide |
| PubChem CID | 42917360 |
| Molecular Formula | C18H18BrN5S2 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide |
| SMILES | Br.c1cncc(/N=c2\scc(-c3cccs3)n2CCCn2ccnc2)c1 |
| InChI | InChI=1S/C18H17N5S2.BrH/c1-4-15(12-19-6-1)21-18-23(9-3-8-22-10-7-20-14-22)16(13-25-18)17-5-2-11-24-17;/h1-2,4-7,10-14H,3,8-9H2;1H/b21-18-; |
| InChIKey | PVWSVENPARPHPV-WIPIHYDQSA-N |
| XLogP | 4.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
The IUPAC name of 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide (CID 42917360) is 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide.
What is the SMILES notation for 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
The canonical SMILES for 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide is Br.c1cncc(/N=c2\scc(-c3cccs3)n2CCCn2ccnc2)c1.
What is the InChIKey of 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
The InChIKey is PVWSVENPARPHPV-WIPIHYDQSA-N. The full InChI is InChI=1S/C18H17N5S2.BrH/c1-4-15(12-19-6-1)21-18-23(9-3-8-22-10-7-20-14-22)16(13-25-18)17-5-2-11-24-17;/h1-2,4-7,10-14H,3,8-9H2;1H/b21-18-;.
What are the key properties of 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide?
3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide has a molecular weight of 448.42 g/mol, XLogP of 4.77, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-imidazol-1-ylpropyl)-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine;hydrobromide is sourced from PubChem (CID 42917360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).