C25H28N4O2S — CID 23790682
4-(2,5-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(3-imidazol-1-ylpropyl)-1,3-thiazol-2-imine (PubChem CID 23790682) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(3-imidazol-1-ylpropyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(3-imidazol-1-ylpropyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23790682 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(3-imidazol-1-ylpropyl)-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(/N=c2\scc(-c3cc(OC)ccc3OC)n2CCCn2ccnc2)cc1 |
| InChI | InChI=1S/C25H28N4O2S/c1-4-19-6-8-20(9-7-19)27-25-29(14-5-13-28-15-12-26-18-28)23(17-32-25)22-16-21(30-2)10-11-24(22)31-3/h6-12,15-18H,4-5,13-14H2,1-3H3/b27-25- |
| InChIKey | LIEJOIQCGQHZBZ-RFBIWTDZSA-N |
| XLogP | 5.32 |
| TPSA | 53.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|