C24H28N2O3S — CID 23770098
4-(2,4-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine (PubChem CID 23770098) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,4-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23770098 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(/N=c2\scc(-c3ccc(OC)cc3OC)n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C24H28N2O3S/c1-4-17-7-9-18(10-8-17)25-24-26(15-20-6-5-13-29-20)22(16-30-24)21-12-11-19(27-2)14-23(21)28-3/h7-12,14,16,20H,4-6,13,15H2,1-3H3/b25-24- |
| InChIKey | YYSGLEGLRLHBLE-IZHYLOQSSA-N |
| XLogP | 5.21 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|