C21H20Cl2N2O2S — CID 23793851
N-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine (PubChem CID 23793851) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23793851 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-(4-methoxyphenyl)-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(-c2cs/c(=N\c3ccc(Cl)cc3Cl)n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c1-26-16-7-4-14(5-8-16)20-13-28-21(25(20)12-17-3-2-10-27-17)24-19-9-6-15(22)11-18(19)23/h4-9,11,13,17H,2-3,10,12H2,1H3/b24-21- |
| InChIKey | AYKPYLMMGAOTFU-FLFQWRMESA-N |
| XLogP | 5.94 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|