C22H25N3O3S2 — CID 27350353
N,N-dimethyl-4-[3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 27350353) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is N,N-dimethyl-4-[3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 27350353 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N,N-dimethyl-4-[3-[[(2S)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2cs/c(=N\c3ccccc3)n2C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-24(2)30(26,27)20-12-10-17(11-13-20)21-16-29-22(23-18-7-4-3-5-8-18)25(21)15-19-9-6-14-28-19/h3-5,7-8,10-13,16,19H,6,9,14-15H2,1-2H3/b23-22-/t19-/m0/s1 |
| InChIKey | PLYMNMZIMYQOHX-ZABCRHKISA-N |
| XLogP | 3.88 |
| TPSA | 63.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|