C25H24N2O2S — CID 23761409
4-(6-methoxynaphthalen-2-yl)-3-(oxolan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 23761409) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-(6-methoxynaphthalen-2-yl)-3-(oxolan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 4-(6-methoxynaphthalen-2-yl)-3-(oxolan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23761409 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-(6-methoxynaphthalen-2-yl)-3-(oxolan-2-ylmethyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | COc1ccc2cc(-c3cs/c(=N\c4ccccc4)n3CC3CCCO3)ccc2c1 |
| InChI | InChI=1S/C25H24N2O2S/c1-28-22-12-11-18-14-20(10-9-19(18)15-22)24-17-30-25(26-21-6-3-2-4-7-21)27(24)16-23-8-5-13-29-23/h2-4,6-7,9-12,14-15,17,23H,5,8,13,16H2,1H3/b26-25- |
| InChIKey | MILGBCKDKOBYHH-QPLCGJKRSA-N |
| XLogP | 5.79 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|