C24H28N2OS — CID 2435615
N-(4-methylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine (PubChem CID 2435615) has the molecular formula C24H28N2OS and a molecular weight of 392.57 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-methylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2435615 |
| Molecular Formula | C24H28N2OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(4-methylphenyl)-3-[[(2S)-oxolan-2-yl]methyl]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(/N=c2\scc(-c3c(C)cc(C)cc3C)n2C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H28N2OS/c1-16-7-9-20(10-8-16)25-24-26(14-21-6-5-11-27-21)22(15-28-24)23-18(3)12-17(2)13-19(23)4/h7-10,12-13,15,21H,5-6,11,14H2,1-4H3/b25-24-/t21-/m0/s1 |
| InChIKey | WLGLEEPXKCJKGJ-VHAJSEAWSA-N |
| XLogP | 5.86 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|