C20H22N2OS2 — CID 23875611
N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23875611) has the molecular formula C20H22N2OS2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23875611 |
| Molecular Formula | C20H22N2OS2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-(4-ethylphenyl)-3-(oxolan-2-ylmethyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(/N=c2\scc(-c3cccs3)n2CC2CCCO2)cc1 |
| InChI | InChI=1S/C20H22N2OS2/c1-2-15-7-9-16(10-8-15)21-20-22(13-17-5-3-11-23-17)18(14-25-20)19-6-4-12-24-19/h4,6-10,12,14,17H,2-3,5,11,13H2,1H3/b21-20- |
| InChIKey | HYJBWYUTBTWGDH-MRCUWXFGSA-N |
| XLogP | 5.25 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|