C24H24N2O2S — CID 2454032
4-(1-benzofuran-2-yl)-N-(4-ethylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-imine (PubChem CID 2454032) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-N-(4-ethylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-N-(4-ethylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2454032 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-N-(4-ethylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(/N=c2\scc(-c3cc4ccccc4o3)n2C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-2-17-9-11-19(12-10-17)25-24-26(15-20-7-5-13-27-20)21(16-29-24)23-14-18-6-3-4-8-22(18)28-23/h3-4,6,8-12,14,16,20H,2,5,7,13,15H2,1H3/b25-24-/t20-/m1/s1 |
| InChIKey | RRUWYRRYPLXAJD-CPSPCKPPSA-N |
| XLogP | 5.94 |
| TPSA | 39.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|