C22H28N3OS2+ — CID 7614906
N-(4-ethylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 7614906) has the molecular formula C22H28N3OS2+ and a molecular weight of 414.62 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(4-ethylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 7614906 |
| Molecular Formula | C22H28N3OS2+ |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-(4-ethylphenyl)-3-(3-morpholin-4-ium-4-ylpropyl)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CCc1ccc(/N=c2\scc(-c3cccs3)n2CCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27N3OS2/c1-2-18-6-8-19(9-7-18)23-22-25(11-4-10-24-12-14-26-15-13-24)20(17-28-22)21-5-3-16-27-21/h3,5-9,16-17H,2,4,10-15H2,1H3/p+1/b23-22- |
| InChIKey | KIIZWDLPZLBMLP-FCQUAONHSA-O |
| XLogP | 3.38 |
| TPSA | 30.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|